ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5658 CAS 1214370-63-4



4-FLUORO-3-PYRIDIN-4-YLBENZALDEHYDE
CAS 1214370-63-4
ID 5658

Molecular Formula   C12H8FNO
Molecular Weight     201.20
SmileCode               C1=CC(=C(C=C1C=O)C2=CC=NC=C2)F

Quantity | Price        5g | 1200 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com