ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5660 CAS 1214366-07-0



METHYL 2-BROMO-4-(TRIFLUOROMETHOXY)BENZOATE
CAS 1214366-07-0
ID 5660

Molecular Formula   C9H6BrF3O3
Molecular Weight     299.04
SmileCode               COC(=O)C1=C(C=C(C=C1)OC(F)(F)F)Br

Quantity | Price        5g | 1220 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com