ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5667 CAS 1772622-45-3



(3,4-DICHLORO-5-METHYLPHENYL)BORONIC ACID
CAS 1772622-45-3
ID 5667

Molecular Formula   C7H7BCl2O2
Molecular Weight     204.84
SmileCode               B(C1=CC(=C(C(=C1)Cl)Cl)C)(O)O

Quantity | Price        5g | 1220 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com