ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5672 CAS 1072951-41-7



[2-FLUORO-5-(MORPHOLINE-4-CARBONYL)PHENYL]BORONIC ACID
CAS 1072951-41-7
ID 5672

Molecular Formula   C11H13BFNO4
Molecular Weight     253.04
SmileCode               B(C1=C(C=CC(=C1)C(=O)N2CCOCC2)F)(O)O

Quantity | Price        5g | 1220 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com