ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5673 CAS 1451392-06-5



(4-CARBAMOYL-2-METHOXYPHENYL)BORONIC ACID
CAS 1451392-06-5
ID 5673

Molecular Formula   C8H10BNO4
Molecular Weight     194.98
SmileCode               B(C1=C(C=C(C=C1)C(=O)N)OC)(O)O

Quantity | Price        5g | 1220 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com