ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5679 CAS 1082041-90-4



5-BROMO-4-CHLORO-1H-INDAZOLE
CAS 1082041-90-4
ID 5679

Molecular Formula   C7H4BrClN2
Molecular Weight     231.48
SmileCode               C1=CC(=C(C2=C1NN=C2)Cl)Br

Quantity | Price        5g | 1230 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com