ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5687 CAS 849758-14-1



(2-METHOXY-4-METHOXYCARBONYLPHENYL)BORONIC ACID
CAS 849758-14-1
ID 5687

Molecular Formula   C9H11BO5
Molecular Weight     209.99
SmileCode               B(C1=C(C=C(C=C1)C(=O)OC)OC)(O)O

Quantity | Price        5g | 1250 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com