ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5693 CAS 444188-28-7



(2-FORMYL-4-METHYLPHENYL)BORONIC ACID
CAS 444188-28-7
ID 5693

Molecular Formula   C8H9BO3
Molecular Weight     163.97
SmileCode               B(C1=C(C=C(C=C1)C)C=O)(O)O

Quantity | Price        5g | 1250 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com