ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5694 CAS 156635-88-0



(3,5-DIFLUORO-4-PHENYLMETHOXYPHENYL)BORONIC ACID
CAS 156635-88-0
ID 5694

Molecular Formula   C13H11BF2O3
Molecular Weight     264.04
SmileCode               B(C1=CC(=C(C(=C1)F)OCC2=CC=CC=C2)F)(O)O

Quantity | Price        5g | 1250 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com