ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5698 CAS 1146614-40-5



[3-FLUORO-5-(HYDROXYMETHYL)PHENYL]BORONIC ACID
CAS 1146614-40-5
ID 5698

Molecular Formula   C7H8BFO3
Molecular Weight     169.95
SmileCode               B(C1=CC(=CC(=C1)F)CO)(O)O

Quantity | Price        5g | 1250 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com