ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5703 CAS 1310416-62-6



1-BROMO-3-ETHOXY-5-(TRIFLUOROMETHYL)BENZENE
CAS 1310416-62-6
ID 5703

Molecular Formula   C9H8BrF3O
Molecular Weight     269.06
SmileCode               CCOC1=CC(=CC(=C1)C(F)(F)F)Br

Quantity | Price        5g | 1250 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com