ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6698 CAS 1021339-16-1



5-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBONITRILE
CAS 1021339-16-1
ID 6698

Molecular Formula   C8H4ClN3
Molecular Weight     177.591
SmileCode               C1=CNC2=NC=C(C(=C21)C#N)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com