ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6700 CAS 1021339-24-1



2-CHLORO-4-PIVALAMIDONICOTINIC ACID
CAS 1021339-24-1
ID 6700

Molecular Formula   C11H13ClN2O3
Molecular Weight     256.686
SmileCode               CC(C)(C)C(=O)NC1=C(C(=NC=C1)Cl)C(=O)O

Quantity | Price        5g | 370 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com