ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6701 CAS 1021339-26-3



N-(2-CHLORO-3-HYDROXYPYRIDIN-4-YL)PIVALAMIDE
CAS 1021339-26-3
ID 6701

Molecular Formula   C10H13ClN2O2
Molecular Weight     228.676
SmileCode               CC(C)(C)C(=O)NC1=C(C(=NC=C1)Cl)O

Quantity | Price        5g | 370 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com