ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6703 CAS 1021339-32-1



2-(TERT-BUTOXYCARBONYLAMINO)-4-CHLORONICOTINIC ACID
CAS 1021339-32-1
ID 6703

Molecular Formula   C11H13ClN2O4
Molecular Weight     272.685
SmileCode               CC(C)(C)OC(=O)NC1=NC=CC(=C1C(=O)O)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com