ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6711 CAS 1034467-33-8



4-CHLORO-3-((TRIMETHYLSILYL)ETHYNYL)PYRIDINE
CAS 1034467-33-8
ID 6711

Molecular Formula   C10H12ClNSi
Molecular Weight     209.748
SmileCode               C[Si](C)(C)C#CC1=C(C=CN=C1)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com