ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6712 CAS 1036027-52-7



5-(TRIFLUOROMETHYL)-3-((TRIMETHYLSILYL)ETHYNYL)PYRIDIN-2-AMINE
CAS 1036027-52-7
ID 6712

Molecular Formula   C11H13F3N2Si
Molecular Weight     258.319
SmileCode               C[Si](C)(C)C#CC1=CC(=CN=C1N)C(F)(F)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com