ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6714 CAS 1040682-46-9



5-BROMO-N,N-DIMETHYL-3-NITROPYRIDIN-2-AMINE
CAS 1040682-46-9
ID 6714

Molecular Formula   C7H8BrN3O2
Molecular Weight     246.064
SmileCode               CN(C)C1=NC=C(C=C1[N+](=O)[O-])Br

Quantity | Price        5g | 370 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com