ID 6718 CAS 1040682-76-5

CAS 1040682-76-5
ID 6718

Molecular Formula   C16H24ClIN2Si
Molecular Weight     434.821
SmileCode               CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C(=CN=C21)Cl)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock

Inquiry : contact[at]