ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6724 CAS 1045855-19-3



TERT-BUTYL 5-METHOXY-3,4-DIHYDRO-1,7-NAPHTHYRIDINE-1(2H)-CARBOXYLATE
CAS 1045855-19-3
ID 6724

Molecular Formula   C14H20N2O3
Molecular Weight     264.325
SmileCode               CC(C)(C)OC(=O)N1CCCC2=C(C=NC=C21)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com