ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6726 CAS 1045855-62-6



3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)-5-METHOXYPYRIDINE
CAS 1045855-62-6
ID 6726

Molecular Formula   C13H23NO2Si
Molecular Weight     253.417
SmileCode               CC(C)(C)[Si](C)(C)OCC1=CC(=CN=C1)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com