ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6729 CAS 1045855-73-9



N,5-DIMETHOXY-N-METHYLNICOTINAMIDE
CAS 1045855-73-9
ID 6729

Molecular Formula   C9H12N2O3
Molecular Weight     196.206
SmileCode               CN(C(=O)C1=CC(=CN=C1)OC)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com