ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6733 CAS 1045858-08-9



TERT-BUTYL 4-IODO-5-METHOXYPYRIDIN-3-YLCARBAMATE
CAS 1045858-08-9
ID 6733

Molecular Formula   C11H15IN2O3
Molecular Weight     350.156
SmileCode               CC(C)(C)OC(=O)NC1=CN=CC(=C1I)OC

Quantity | Price        5g | 370 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com