ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6736 CAS 1045858-18-1



TERT-BUTYL 5-METHOXY-4-(TRIMETHYLSILYL)PYRIDIN-3-YLCARBAMATE
CAS 1045858-18-1
ID 6736

Molecular Formula   C14H24N2O3Si
Molecular Weight     296.442
SmileCode               CC(C)(C)OC(=O)NC1=CN=CC(=C1[Si](C)(C)C)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com