ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6738 CAS 1045858-57-8



METHYL 3-(3-AMINO-5-METHOXYPYRIDIN-4-YL)ACRYLATE
CAS 1045858-57-8
ID 6738

Molecular Formula   C10H12N2O3
Molecular Weight     208.217
SmileCode               COC1=C(C(=CN=C1)N)C=CC(=O)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com