ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6739 CAS 1045859-16-2



TERT-BUTYL 4-ALLYL-5-METHOXYPYRIDIN-3-YLCARBAMATE
CAS 1045859-16-2
ID 6739

Molecular Formula   C14H20N2O3
Molecular Weight     264.325
SmileCode               CC(C)(C)OC(=O)NC1=CN=CC(=C1CC=C)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com