ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6741 CAS 104830-08-2



3-(2-CHLORO-PYRIDIN-3-YL)-ACRYLIC ACID ETHYL ESTER
CAS 104830-08-2
ID 6741

Molecular Formula   C10H10ClNO2
Molecular Weight     211.645
SmileCode               CCOC(=O)C=CC1=C(N=CC=C1)Cl

Quantity | Price        5g | 820 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com