ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6743 CAS 1049677-55-5



TERT-BUTYL 4,5-DIMETHOXYPYRIDIN-3-YLCARBAMATE
CAS 1049677-55-5
ID 6743

Molecular Formula   C12H18N2O4
Molecular Weight     254.286
SmileCode               CC(C)(C)OC(=O)NC1=CN=CC(=C1OC)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com