ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6751 CAS 1072139-91-3



METHYL 3-(2-AMINO-4-METHOXYPYRIDIN-3-YL)ACRYLATE
CAS 1072139-91-3
ID 6751

Molecular Formula   C10H12N2O3
Molecular Weight     208.217
SmileCode               COC1=C(C(=NC=C1)N)C=CC(=O)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com