ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6753 CAS 1072145-24-4



4-CHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1072145-24-4
ID 6753

Molecular Formula   C13H16BClN2O2
Molecular Weight     278.543
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CN=C3C(=C2Cl)C=CN3

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com