ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6757 CAS 1072933-64-2



3-METHOXY-5-(2-METHYL-1,3-DIOXOLAN-2-YL)PYRIDINE
CAS 1072933-64-2
ID 6757

Molecular Formula   C10H13NO3
Molecular Weight     195.218
SmileCode               CC1(OCCO1)C2=CC(=CN=C2)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com