ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6758 CAS 1073371-98-8



2,5-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS 1073371-98-8
ID 6758

Molecular Formula   C11H14BCl2NO2
Molecular Weight     273.948
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2Cl)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com