ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6759 CAS 1083168-84-6



2-METHOXY-5-METHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS 1083168-84-6
ID 6759

Molecular Formula   C13H20BNO3
Molecular Weight     249.117
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2OC)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com