ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6760 CAS 1083168-92-6



2,3-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS 1083168-92-6
ID 6760

Molecular Formula   C13H20BNO4
Molecular Weight     265.116
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OC)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com