ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6761 CAS 1083168-96-0



5-CHLORO-2-METHOXY-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS 1083168-96-0
ID 6761

Molecular Formula   C12H17BClNO3
Molecular Weight     269.532
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2OC)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com