ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6762 CAS 1086390-83-1



1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXAMIDE
CAS 1086390-83-1
ID 6762

Molecular Formula   C8H7N3O
Molecular Weight     161.164
SmileCode               C1=CNC2=NC=CC(=C21)C(=O)N

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com