ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6764 CAS 1087659-16-2



4-IODO-5-METHOXY-N-PHENYLNICOTINAMIDE
CAS 1087659-16-2
ID 6764

Molecular Formula   C13H11IN2O2
Molecular Weight     354.147
SmileCode               COC1=C(C(=CN=C1)C(=O)NC2=CC=CC=C2)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com