ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6767 CAS 1087659-19-5



3-METHOXY-5-(PHENYLCARBAMOYL)ISONICOTINIC ACID
CAS 1087659-19-5
ID 6767

Molecular Formula   C14H12N2O4
Molecular Weight     272.260
SmileCode               COC1=C(C(=CN=C1)C(=O)NC2=CC=CC=C2)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com