ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6769 CAS 1087659-21-9



5-BROMOPYRIDIN-3-YL TERT-BUTYL CARBONATE
CAS 1087659-21-9
ID 6769

Molecular Formula   C10H12BrNO3
Molecular Weight     274.114
SmileCode               CC(C)(C)OC(=O)OC1=CC(=CN=C1)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com