ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6771 CAS 1087659-23-1



5-BROMO-3-METHOXY-2-((TRIMETHYLSILYL)ETHYNYL)PYRIDINE
CAS 1087659-23-1
ID 6771

Molecular Formula   C11H14BrNOSi
Molecular Weight     284.228
SmileCode               COC1=CC(=CN=C1C#C[Si](C)(C)C)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com