ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6773 CAS 1087659-25-3



5-BROMO-3-METHOXY-2-(TRIMETHYLSILYL)PYRIDINE
CAS 1087659-25-3
ID 6773

Molecular Formula   C9H14BrNOSi
Molecular Weight     260.206
SmileCode               COC1=CC(=CN=C1[Si](C)(C)C)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com