ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6774 CAS 1087659-26-4



2-BROMO-6-IODOPYRIDIN-3-YL TERT-BUTYL CARBONATE
CAS 1087659-26-4
ID 6774

Molecular Formula   C10H11BrINO3
Molecular Weight     400.010
SmileCode               CC(C)(C)OC(=O)OC1=C(N=C(C=C1)I)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com