ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6783 CAS 1092381-05-9



2-(CHLOROMETHYL)-1-PROPYL-1H-IMIDAZO[4,5-C]PYRIDINE HYDROCHLORIDE
CAS 1092381-05-9
ID 6783

Molecular Formula   C10H13Cl2N3
Molecular Weight     246.135
SmileCode               CCCN1C2=C(C=NC=C2)N=C1CCl.Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com