ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6787 CAS 1105675-62-4



5-METHOXY-N-PHENYL-4-(TRIMETHYLSILYL)NICOTINAMIDE
CAS 1105675-62-4
ID 6787

Molecular Formula   C16H20N2O2Si
Molecular Weight     300.433
SmileCode               COC1=C(C(=CN=C1)C(=O)NC2=CC=CC=C2)[Si](C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com