ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6790 CAS 1105675-65-7



5-METHOXY-N,4-DIMETHYL-N-PHENYLNICOTINAMIDE
CAS 1105675-65-7
ID 6790

Molecular Formula   C15H16N2O2
Molecular Weight     256.305
SmileCode               CC1=C(C=NC=C1C(=O)N(C)C2=CC=CC=C2)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com