ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6792 CAS 1111638-01-7



5-BROMO-2-METHYL-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1111638-01-7
ID 6792

Molecular Formula   C14H11BrN2O2S
Molecular Weight     351.218
SmileCode               CC1=CC2=CC(=CN=C2N1S(=O)(=O)C3=CC=CC=C3)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com