ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6800 CAS 112766-32-2



1H-PYRROLO[3,2-B]PYRIDINE-6-CARBOXYLIC ACID
CAS 112766-32-2
ID 6800

Molecular Formula   C8H6N2O2
Molecular Weight     162.148
SmileCode               C1=CNC2=C1N=CC(=C2)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com