ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6804 CAS 1131335-38-0



TERT-BUTYL 5-METHOXYPYRIDIN-3-YL CARBONATE
CAS 1131335-38-0
ID 6804

Molecular Formula   C11H15NO4
Molecular Weight     225.244
SmileCode               CC(C)(C)OC(=O)OC1=CC(=CN=C1)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com