ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6812 CAS 1131335-75-5



2,3-DIMETHOXY-5-(TRIMETHYLSILYL)PYRIDINE
CAS 1131335-75-5
ID 6812

Molecular Formula   C10H17NO2Si
Molecular Weight     211.336
SmileCode               COC1=CC(=CN=C1OC)[Si](C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com