ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 6820 CAS 1138443-91-0



3-(DIMETHOXYMETHYL)-5-METHOXY-4-(TRIMETHYLSILYL)PYRIDINE
CAS 1138443-91-0
ID 6820

Molecular Formula   C12H21NO3Si
Molecular Weight     255.389
SmileCode               COC1=C(C(=CN=C1)C(OC)OC)[Si](C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com